Carbamic acid,N-[1,1'-biphenyl]-2-yl-, ethyl ester structure
|
Common Name | Carbamic acid,N-[1,1'-biphenyl]-2-yl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6301-18-4 | Molecular Weight | 241.28500 | |
| Density | 1.145g/cm3 | Boiling Point | 340.9ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | ethyl N-(2-phenylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 340.9ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 160ºC |
| Exact Mass | 241.11000 |
| PSA | 38.33000 |
| LogP | 3.99500 |
| Index of Refraction | 1.594 |
| InChIKey | SMZPSCLWIVWFLG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccccc1-c1ccccc1 |
|
~94%
Carbamic acid,N... CAS#:6301-18-4 |
| Literature: Peters, Jens-Uwe; Galley, Guido; Jacobsen, Helmut; Czech, Christian; David-Pierson, Pascale; Kitas, Eric A.; Ozmen, Laurence Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 21 p. 5918 - 5923 |
|
~77%
Carbamic acid,N... CAS#:6301-18-4 |
| Literature: Baumann, Marcus; Baxendale, Ian R.; Ley, Steven V.; Nikbin, Nikzad; Smith, Christopher D.; Tierney, Jason P. Organic and Biomolecular Chemistry, 2008 , vol. 6, # 9 p. 1577 - 1586 |
|
~%
Carbamic acid,N... CAS#:6301-18-4 |
| Literature: Pictet; Hubert Chemische Berichte, 1896 , vol. 29, p. 1191 |
| biphenyl-2-yl-carbamic acid ethyl ester |
| o-Diphenylyl-carbamidsaeure-aethylester |
| Biphenyl-2-yl-carbamidsaeure-aethylester |
| o-Xenyl-urethan |
| 2-ethoxycarbonylaminobiphenyl |
| ethyl 2-biphenylylcarbamate |
| 2-Aethoxycarbonylaminobiphenyl |