N-(2-bromoethyl)-2-nitrobenzamide
Modify Date: 2025-11-25 09:29:28
N-(2-bromoethyl)-2-nitrobenzamide structure
|
Common Name | N-(2-bromoethyl)-2-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 63004-24-0 | Molecular Weight | 273.08300 | |
| Density | 1.594g/cm3 | Boiling Point | 425.5ºC at 760 mmHg | |
| Molecular Formula | C9H9BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | N-(2-bromoethyl)-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.594g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760 mmHg |
| Molecular Formula | C9H9BrN2O3 |
| Molecular Weight | 273.08300 |
| Flash Point | 211.1ºC |
| Exact Mass | 271.98000 |
| PSA | 78.41000 |
| LogP | 2.81750 |
| Index of Refraction | 1.602 |
| InChIKey | VNYZLKGRVHTMIQ-UHFFFAOYSA-N |
| SMILES | O=C(NCCBr)c1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
N-(2-bromoethyl... CAS#:63004-24-0 |
| Literature: Leffler; Adams Journal of the American Chemical Society, 1937 , vol. 59, p. 2252,2256 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:3416-93-1| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzamide,N-(2-bromoethyl)-2-nitro |
| 2-Nitro-benzoesaeure-(2-brom-aethylamid) |
| 2-nitro-benzoic acid-(2-bromo-ethylamide) |
| EINECS 263-786-6 |