4-(2,3-dichloro-4-methoxyphenyl)-4-oxobutanoic acid
Modify Date: 2025-09-23 11:07:02
4-(2,3-dichloro-4-methoxyphenyl)-4-oxobutanoic acid structure
|
Common Name | 4-(2,3-dichloro-4-methoxyphenyl)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 63001-48-9 | Molecular Weight | 277.10100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,3-dichloro-4-methoxyphenyl)-4-oxobutanoic acid |
|---|
| Molecular Formula | C11H10Cl2O4 |
|---|---|
| Molecular Weight | 277.10100 |
| Exact Mass | 275.99600 |
| PSA | 63.60000 |
| LogP | 3.04950 |
| InChIKey | LOUFQFODXAPOPP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCC(=O)O)c(Cl)c1Cl |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |