N-(2-(3,4-Diethoxyphenyl)ethyl)-2-(3,4-diethoxyphenyl)acetamide structure
|
Common Name | N-(2-(3,4-Diethoxyphenyl)ethyl)-2-(3,4-diethoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 6298-46-0 | Molecular Weight | 415.52300 | |
| Density | 1.082g/cm3 | Boiling Point | 595ºC at 760 mmHg | |
| Molecular Formula | C24H33NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.6ºC | |
| Name | 2-(3,4-diethoxyphenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082g/cm3 |
|---|---|
| Boiling Point | 595ºC at 760 mmHg |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.52300 |
| Flash Point | 313.6ºC |
| Exact Mass | 415.23600 |
| PSA | 66.02000 |
| LogP | 4.57370 |
| Index of Refraction | 1.529 |
| InChIKey | WXWBNUBJVJKZAS-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(CCNC(=O)Cc2ccc(OCC)c(OCC)c2)cc1OCC |
|
~%
N-(2-(3,4-Dieth... CAS#:6298-46-0 |
| Literature: Weijlard; Swanezy; Tashjian Journal of the American Chemical Society, 1949 , vol. 71, p. 1889 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Einecs 228-573-4 |
| 3.4-Diethoxyphenylacetyl-3.4-diethoxyphenethylamin |