(5-oxo-5-phenylpentan-2-yl) benzoate structure
|
Common Name | (5-oxo-5-phenylpentan-2-yl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 62973-34-6 | Molecular Weight | 282.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-oxo-5-phenylpentan-2-yl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18O3 |
|---|---|
| Molecular Weight | 282.33400 |
| Exact Mass | 282.12600 |
| PSA | 43.37000 |
| LogP | 3.89500 |
| InChIKey | PSQFZKMKKOUIAW-UHFFFAOYSA-N |
| SMILES | CC(CCC(=O)c1ccccc1)OC(=O)c1ccccc1 |
|
~%
(5-oxo-5-phenyl... CAS#:62973-34-6 |
| Literature: Ishido,Y. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 521 - 530 |
| 3-Benzoyl-1-methylpropylbenzoat |
| 1-Pentanone,4-(benzoyloxy)-1-phenyl |