2-(benzylsulfonylamino)-4-methyl-pentanoic acid
Modify Date: 2025-08-26 09:56:22
2-(benzylsulfonylamino)-4-methyl-pentanoic acid structure
|
Common Name | 2-(benzylsulfonylamino)-4-methyl-pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6297-57-0 | Molecular Weight | 285.35900 | |
| Density | 1.24g/cm3 | Boiling Point | 464.1ºC at 760mmHg | |
| Molecular Formula | C13H19NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.5ºC | |
| Name | N-(phenylmethanesulfonyl)-L-leucine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 464.1ºC at 760mmHg |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.35900 |
| Flash Point | 234.5ºC |
| Exact Mass | 285.10300 |
| PSA | 91.85000 |
| LogP | 3.07700 |
| InChIKey | SXWRIQLFHIQDFV-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NS(=O)(=O)Cc1ccccc1)C(=O)O |
|
~50%
2-(benzylsulfon... CAS#:6297-57-0 |
| Literature: Radau, Gregor; Schermuly, Sonja; Fritsche, Alexandra Archiv der Pharmazie, 2003 , vol. 336, # 6-7 p. 300 - 309 |
|
~%
2-(benzylsulfon... CAS#:6297-57-0 |
| Literature: Milne; Peng Journal of the American Chemical Society, 1957 , vol. 79, p. 639,642 |
|
~%
2-(benzylsulfon... CAS#:6297-57-0 |
| Literature: Radau, Gregor; Schermuly, Sonja; Fritsche, Alexandra Archiv der Pharmazie, 2003 , vol. 336, # 6-7 p. 300 - 309 |
CAS#:3303-31-9![Leucine,N-[N-(benzylsulfonyl)-L-leucyl]-, ethyl ester, L- (8CI) structure](https://image.chemsrc.com/caspic/234/3253-28-9.png)
CAS#:3253-28-9![2-[[2-(benzylsulfonylamino)-4-methyl-pentanoyl]amino]-4-methyl-pentanoic acid structure](https://image.chemsrc.com/caspic/222/7474-68-2.png)
CAS#:7474-68-2| Phenylmethanesulfinmorpholide |
| 1-(benzylthio)morpholine |
| N-Benzylthiomorpholine |
| Morpholine,4-[(phenylmethyl)thio] |
| 4-benzylsulfanyl-morpholine |
| N,N-(3-Oxapentamethylen)>-phenylmethansulfenamid |
| N-benzyl-sulfenylmorpholine |
| N-phenylmethanesulfonyl-L-leucine |
| N-(Phenylmethansulfenyl)morpholin |
| 4-morpholinyl benzyl sulfide |
| N-benzylsulfonyl-D,L-leucine |
| N-Phenylmethansulfonyl-L-leucin |