Octanoicacid, 2-(benzoylamino)-
Modify Date: 2025-09-11 08:18:28
Octanoicacid, 2-(benzoylamino)- structure
|
Common Name | Octanoicacid, 2-(benzoylamino)- | ||
|---|---|---|---|---|
| CAS Number | 6294-94-6 | Molecular Weight | 263.33200 | |
| Density | 1.095g/cm3 | Boiling Point | 482.2ºC at 760mmHg | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.4ºC | |
| Name | 2-benzamidooctanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 482.2ºC at 760mmHg |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.33200 |
| Flash Point | 245.4ºC |
| Exact Mass | 263.15200 |
| PSA | 66.40000 |
| LogP | 3.23090 |
| Index of Refraction | 1.526 |
| InChIKey | YQGXRDXMBQRPDW-UHFFFAOYSA-N |
| SMILES | CCCCCCC(NC(=O)c1ccccc1)C(=O)O |
|
~%
Octanoicacid, 2... CAS#:6294-94-6 |
| Literature: Albertson Journal of the American Chemical Society, 1946 , vol. 68, p. 450,451 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:116783-26-7| 2-Benzamino-caprylsaeure |
| N-Benzoyl-DL-2-amino-octansaeure |
| dl-2-Benzamidooctanoic acid |
| 2-Benzoylamino-octansaeure |
| 2-benzoylamino-octanoic acid |
| Octanoicacid,2-(benzoylamino) |