Iodonium, diphenyl-, 4-methylbenzenesulfonate (9CI) structure
|
Common Name | Iodonium, diphenyl-, 4-methylbenzenesulfonate (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6293-66-9 | Molecular Weight | 452.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17IO3S | Melting Point | 188-191ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | diphenyliodanium,4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 188-191ºC(lit.) |
|---|---|
| Molecular Formula | C19H17IO3S |
| Molecular Weight | 452.30600 |
| Exact Mass | 451.99400 |
| PSA | 65.58000 |
| LogP | 1.79490 |
| InChIKey | UMIKAXKFQJWKCV-UHFFFAOYSA-M |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.c1ccc([I+]c2ccccc2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Naloxone inhibits immune cell function by suppressing superoxide production through a direct interaction with gp91phox subunit of NADPH oxidase.
J. Neuroinflammation 9 , 32, (2012) Both (-) and (+)-naloxone attenuate inflammation-mediated neurodegeneration by inhibition of microglial activation through superoxide reduction in an opioid receptor-independent manner. Multiple lines... |
|
|
Unforeseen decreases in dissolved oxygen levels affect tube formation kinetics in collagen gels.
Am. J. Physiol. Cell Physiol. 301(2) , C431-40, (2011) The availability of oxygen (O(2)) is a critical parameter affecting vascular tube formation. In this study, we hypothesize that dissolved oxygen (DO) levels in collagen gels change during the three-di... |
|
|
Reactive oxygen species facilitate translocation of hormone sensitive lipase to the lipid droplet during lipolysis in human differentiated adipocytes.
PLoS ONE 7(4) , e34904, (2012) In obesity, there is an increase in reactive oxygen species (ROS) within adipose tissue caused by increases in inflammation and overnutrition. Hormone sensitive lipase (HSL) is part of the canonical l... |
| DPIpTS |
| diphenyliodonium p-toluenesulfonate |
| Toluol-4-sulfonsaeure,Diphenyljodonium-Salz |
| diphenyliodonium tosylate |
| Iodonium,p-toluenesulfonate |
| toluene-4-sulfonic acid,diphenyliodonium-salt |
| Diphenyliodonium 4-methylbenzenesulfonate |
| MFCD00467678 |
| IODONIUM,DIPHENYL-,p-TOLUENESULFONATE |