(12S,3E,5S,13E,15Z)-7t-acetoxy-15,6,11,9c,11t-pentahydroxy-5r-methoxy-12,4,6t,8c,10c,12t,16-heptamethyl-19-propyl-19,10-dihydro-2-oxa-1(2,8)-furo[2',3':5,6]benzo[1,2-g]quinazolina-cyclohexadecaphane-3,13,15-trien-11-one structure
|
Common Name | (12S,3E,5S,13E,15Z)-7t-acetoxy-15,6,11,9c,11t-pentahydroxy-5r-methoxy-12,4,6t,8c,10c,12t,16-heptamethyl-19-propyl-19,10-dihydro-2-oxa-1(2,8)-furo[2',3':5,6]benzo[1,2-g]quinazolina-cyclohexadecaphane-3,13,15-trien-11-one | ||
|---|---|---|---|---|
| CAS Number | 62921-37-3 | Molecular Weight | 750.87400 | |
| Density | 1.32g/cm3 | Boiling Point | 856.8ºC at 760 mmHg | |
| Molecular Formula | C41H54N2O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 472ºC | |
| Name | (12S,3E,5S,13E,15Z)-7t-acetoxy-15,6,11,9c,11t-pentahydroxy-5r-methoxy-12,4,6t,8c,10c,12t,16-heptamethyl-19-propyl-19,10-dihydro-2-oxa-1(2,8)-furo[2',3':5,6]benzo[1,2-g]quinazolina-cyclohexadecaphane-3,13,15-trien-11-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 856.8ºC at 760 mmHg |
| Molecular Formula | C41H54N2O11 |
| Molecular Weight | 750.87400 |
| Flash Point | 472ºC |
| Exact Mass | 750.37300 |
| PSA | 187.81000 |
| LogP | 5.44470 |
| Index of Refraction | 1.607 |
| InChIKey | QSZZXTYZIVELKY-MSAIXKDESA-N |
| SMILES | CCCN1Cc2c3c(O)c4c(O)c(C)c5c(c4c2O)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C1=N3)O5 |
|
~%
(12S,3E,5S,13E,... CAS#:62921-37-3 |
| Literature: McCarthy; Moore; Wysong; Aldrich Journal of Medicinal Chemistry, 1977 , vol. 20, # 10 p. 1272 - 1276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,15-Didehydro-15-deoxo-3,15-epi<methano-(n-propylimino)>rifamycin sv |
| 15,3-(1-propyl-1-aza-ethane-1,2-diyl)-15,N-didehydro-15-deoxo-rifamycin |
| 3-(propylamino-methyl)-rifamycin cycloamidine |