4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide,(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol
Modify Date: 2024-09-02 18:28:43
4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide,(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol structure
|
Common Name | 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide,(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol | ||
|---|---|---|---|---|
| CAS Number | 62907-78-2 | Molecular Weight | 475.51700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H29N5O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-N-(3-methoxypyrazin-2-yl)benzenesulfonamide,(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H29N5O8S |
|---|---|
| Molecular Weight | 475.51700 |
| Exact Mass | 475.17400 |
| PSA | 231.99000 |
| InChIKey | UKWKONPBWFVGDZ-WZTVWXICSA-N |
| SMILES | CNCC(O)C(O)C(O)C(O)CO.COc1nccnc1NS(=O)(=O)c1ccc(N)cc1 |
| N-Methylglucamine and sulfalene |
| Sulfalene N-methylglucamine salt |
| (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| D-Glucitol,1-deoxy-1-(methylamino)-,compd. with 4-amino-N-(3-methoxy-1-piperazinyl)benzenesulfonamide |