Hexanedioic acid,ethylidene di-2-propenyl ester (9CI)
Modify Date: 2025-09-15 12:14:38
Hexanedioic acid,ethylidene di-2-propenyl ester (9CI) structure
|
Common Name | Hexanedioic acid,ethylidene di-2-propenyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6286-34-6 | Molecular Weight | 398.44700 | |
| Density | 1.097g/cm3 | Boiling Point | 460.6ºC at 760 mmHg | |
| Molecular Formula | C20H30O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.3ºC | |
| Name | 8-methyl-6,10-dioxo-7,9-dioxa-pentadecanedioic acid diallyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 460.6ºC at 760 mmHg |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.44700 |
| Flash Point | 196.3ºC |
| Exact Mass | 398.19400 |
| PSA | 105.20000 |
| LogP | 2.99800 |
| Index of Refraction | 1.469 |
| InChIKey | KXWGQGDRVCQEJN-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)CCCCC(=O)OC(C)OC(=O)CCCCC(=O)OCC=C |
|
~%
Hexanedioic aci... CAS#:6286-34-6 |
| Literature: Hurd et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 104 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 8-Methyl-6,10-dioxo-7,9-dioxa-pentadecandisaeure-diallylester |