2,4-dichloro-1-[(2,4-dichlorophenyl)sulfanylamino]sulfanylbenzene
Modify Date: 2025-10-01 16:36:18
![2,4-dichloro-1-[(2,4-dichlorophenyl)sulfanylamino]sulfanylbenzene Structure](https://image.chemsrc.com/caspic/049/62858-46-2.png)
2,4-dichloro-1-[(2,4-dichlorophenyl)sulfanylamino]sulfanylbenzene structure
|
Common Name | 2,4-dichloro-1-[(2,4-dichlorophenyl)sulfanylamino]sulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 62858-46-2 | Molecular Weight | 371.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7Cl4NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dichloro-1-[(2,4-dichlorophenyl)sulfanylamino]sulfanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7Cl4NS2 |
|---|---|
| Molecular Weight | 371.13300 |
| Exact Mass | 368.87700 |
| PSA | 62.63000 |
| LogP | 6.99510 |
| InChIKey | UFLZNPAOMLXWRX-UHFFFAOYSA-N |
| SMILES | Clc1ccc(SNSc2ccc(Cl)cc2Cl)c(Cl)c1 |
|
~%
2,4-dichloro-1-... CAS#:62858-46-2 |
| Literature: Miura,Y. et al. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 482 - 486 |
| Benzenesulfenamide,2,4-dichloro-N-[(2,4-dichlorophenyl)thio] |
| 2,2',4,4'-Tetrachlordibenzolsulfenamid |