3-[(3-Carboxyphenyl)carbamoyl]pyridine 1-oxide
Modify Date: 2025-08-30 18:17:45
![3-[(3-Carboxyphenyl)carbamoyl]pyridine 1-oxide Structure](https://image.chemsrc.com/caspic/228/62833-95-8.png)
3-[(3-Carboxyphenyl)carbamoyl]pyridine 1-oxide structure
|
Common Name | 3-[(3-Carboxyphenyl)carbamoyl]pyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 62833-95-8 | Molecular Weight | 258.22900 | |
| Density | 1.36g/cm3 | Boiling Point | 473.1ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.9ºC | |
| Name | 3-[(1-oxidopyridin-1-ium-3-carbonyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 473.1ºC at 760 mmHg |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.22900 |
| Flash Point | 239.9ºC |
| Exact Mass | 258.06400 |
| PSA | 95.35000 |
| LogP | 2.44960 |
| Index of Refraction | 1.633 |
| InChIKey | QNLBGYALRQFXIA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(NC(=O)c2ccc[n+]([O-])c2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Nicotinamide,N-(m-carboxyphenyl)-,1-oxide |
| 3-((3-Pyridinylcarbonyl)amino)benzoic acid N-oxide |
| BENZOIC ACID,3-((3-PYRIDINYLCARBONYL)AMINO)-,N-OXIDE |
| N-(3-Carboxyphenyl)nicotinamide 1-oxide |
| Benzoic acid,m-nicotinamido-,1'-oxide |