Propanoic acid,2-(acetyloxy)-, octyl ester
Modify Date: 2025-11-19 10:52:54
Propanoic acid,2-(acetyloxy)-, octyl ester structure
|
Common Name | Propanoic acid,2-(acetyloxy)-, octyl ester | ||
|---|---|---|---|---|
| CAS Number | 6283-90-5 | Molecular Weight | 244.32700 | |
| Density | 0.975g/cm3 | Boiling Point | 307.1ºC at 760 mmHg | |
| Molecular Formula | C13H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.3ºC | |
| Name | octyl 2-acetyloxypropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.975g/cm3 |
|---|---|
| Boiling Point | 307.1ºC at 760 mmHg |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.32700 |
| Flash Point | 141.3ºC |
| Exact Mass | 244.16700 |
| PSA | 52.60000 |
| LogP | 2.84170 |
| Index of Refraction | 1.438 |
| InChIKey | UMNCSZZKGJUPKA-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)C(C)OC(C)=O |
|
~%
Propanoic acid,... CAS#:6283-90-5 |
| Literature: Rehberg; Dixon Journal of the American Chemical Society, 1950 , vol. 72, p. 1918,1919 |
|
~%
Propanoic acid,... CAS#:6283-90-5 |
| Literature: Rehberg; Dixon Journal of the American Chemical Society, 1950 , vol. 72, p. 1918,1919 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| octyl 2-acetoxypropanoate |