(5E)-5-[(4-methylphenyl)hydrazinylidene]-6-oxo-naphthalene-2-sulfonic acid
Modify Date: 2025-08-23 18:02:07
![(5E)-5-[(4-methylphenyl)hydrazinylidene]-6-oxo-naphthalene-2-sulfonic acid Structure](https://image.chemsrc.com/caspic/184/6283-28-9.png)
(5E)-5-[(4-methylphenyl)hydrazinylidene]-6-oxo-naphthalene-2-sulfonic acid structure
|
Common Name | (5E)-5-[(4-methylphenyl)hydrazinylidene]-6-oxo-naphthalene-2-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6283-28-9 | Molecular Weight | 365.35900 | |
| Density | 1.4g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H14N2NaO4S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-methylphenyl)hydrazinylidene]-6-oxonaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Molecular Formula | C17H14N2NaO4S+ |
| Molecular Weight | 365.35900 |
| Exact Mass | 365.05700 |
| PSA | 107.70000 |
| LogP | 5.59670 |
| Index of Refraction | 1.664 |
| InChIKey | SMQYMAVYZRHNIE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=Nc2c(O)ccc3cc(S(=O)(=O)O)ccc23)cc1 |
|
~%
(5E)-5-[(4-meth... CAS#:6283-28-9 |
| Literature: Hamada, Kunihiro; Fujita, Mahito; Mitsuishi, Masaru Journal of the Chemical Society, Faraday Transactions, 1990 , vol. 86, # 24 p. 4031 - 4035 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (5E)-5-[(4-methylphenyl)hydrazinylidene]-6-oxo-naphthalene-2-sulfonic acid |
| 6-hydroxy-5-((4-methylphenyl)diazenyl)-2-naphthalenesulfonic acid |