Phenol,3,4,6-trichloro-2-[(2,3,5-trichloro-6-methoxyphenyl)methyl]- structure
|
Common Name | Phenol,3,4,6-trichloro-2-[(2,3,5-trichloro-6-methoxyphenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 6282-18-4 | Molecular Weight | 420.93000 | |
| Density | 1.6g/cm3 | Boiling Point | 469.7ºC at 760mmHg | |
| Molecular Formula | C14H8Cl6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.8ºC | |
| Name | Hexachlorophen-monomethylether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 469.7ºC at 760mmHg |
| Molecular Formula | C14H8Cl6O2 |
| Molecular Weight | 420.93000 |
| Flash Point | 237.8ºC |
| Exact Mass | 417.86600 |
| PSA | 29.46000 |
| LogP | 6.91200 |
| Index of Refraction | 1.629 |
| InChIKey | LXTWGNTXYNZDNB-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)cc(Cl)c(Cl)c1Cc1c(O)c(Cl)cc(Cl)c1Cl |
|
~%
Phenol,3,4,6-tr... CAS#:6282-18-4 |
| Literature: Gen. Aniline and Film Corp. Patent: US2684386 , 1950 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,3',5,5',6,6'-Hexachlor-2-hydroxy-2'-methoxy-diphenylmethan |