2 (1H)-Pyrimidinone, 4-amino-1-(2, 3-dihydroxy-4-(hydroxymethyl)cyclopentyl)-,(1.alpha.,2.beta., 3.beta.,4.alpha.)- (PM)- structure
|
Common Name | 2 (1H)-Pyrimidinone, 4-amino-1-(2, 3-dihydroxy-4-(hydroxymethyl)cyclopentyl)-,(1.alpha.,2.beta., 3.beta.,4.alpha.)- (PM)- | ||
|---|---|---|---|---|
| CAS Number | 62805-43-0 | Molecular Weight | 241.24400 | |
| Density | 1.74g/cm3 | Boiling Point | 477ºC at 760 mmHg | |
| Molecular Formula | C10H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.3ºC | |
| Name | 4-amino-1-[(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 477ºC at 760 mmHg |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.24400 |
| Flash Point | 242.3ºC |
| Exact Mass | 241.10600 |
| PSA | 121.60000 |
| Index of Refraction | 1.743 |
| InChIKey | UAZJPMMKWBPACD-UXXCCHNYSA-N |
| SMILES | Nc1ccn(C2CC(CO)C(O)C2O)c(=O)n1 |
|
~86%
2 (1H)-Pyrimidi... CAS#:62805-43-0 |
| Literature: Shealy; O'Dell Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 2 p. 353 - 358 |
|
~%
2 (1H)-Pyrimidi... CAS#:62805-43-0 |
| Literature: Shealy; O'Dell Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 2 p. 353 - 358 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| racemic carbodine |