(2-methylphenyl) 3-chlorobenzoate structure
|
Common Name | (2-methylphenyl) 3-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 6280-51-9 | Molecular Weight | 246.68900 | |
| Density | 1.226g/cm3 | Boiling Point | 405.3ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.5ºC | |
| Name | (2-methylphenyl) 3-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 405.3ºC at 760 mmHg |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.68900 |
| Flash Point | 217.5ºC |
| Exact Mass | 246.04500 |
| PSA | 26.30000 |
| LogP | 3.86760 |
| Index of Refraction | 1.587 |
| InChIKey | STZGPDUHJIINTD-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OC(=O)c1cccc(Cl)c1 |
|
~%
(2-methylphenyl... CAS#:6280-51-9 |
| Literature: Huston; Robinson Journal of the American Chemical Society, 1951 , vol. 73, p. 2483,2486 |
| 3-Chlor-benzoesaeure-o-kresylester |
| 3-chloro-benzoic acid o-tolyl ester |
| 3-Chlor-benzoesaeure-o-tolylester |
| o-cresyl m-chlorobenzoate |
| 2-methylphenyl 3-chlorobenzoate |