3-methyl-3,4-diphenyl-butanoic acid structure
|
Common Name | 3-methyl-3,4-diphenyl-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6279-96-5 | Molecular Weight | 254.32400 | |
| Density | 1.115g/cm3 | Boiling Point | 371ºC at 760 mmHg | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.9ºC | |
| Name | 3-methyl-3,4-diphenylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 371ºC at 760 mmHg |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.32400 |
| Flash Point | 267.9ºC |
| Exact Mass | 254.13100 |
| PSA | 37.30000 |
| LogP | 3.66170 |
| Index of Refraction | 1.574 |
| InChIKey | ZCFZXTJJDYFYJF-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)(Cc1ccccc1)c1ccccc1 |
|
~%
3-methyl-3,4-di... CAS#:6279-96-5 |
| Literature: Fuson et al. Journal of Organic Chemistry, 1951 , vol. 16, p. 1529,1232 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-methyl-3,4-diphenyl-butyric acid |
| 3-Methyl-3,4-diphenyl-buttersaeure |