Methanone, (2-bromophenyl)(2,4,6-trimethylphenyl)- structure
|
Common Name | Methanone, (2-bromophenyl)(2,4,6-trimethylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6279-93-2 | Molecular Weight | 303.19400 | |
| Density | 1.303g/cm3 | Boiling Point | 360.4ºC at 760mmHg | |
| Molecular Formula | C16H15BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 23.2ºC | |
| Name | (2-bromophenyl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 360.4ºC at 760mmHg |
| Molecular Formula | C16H15BrO |
| Molecular Weight | 303.19400 |
| Flash Point | 23.2ºC |
| Exact Mass | 302.03100 |
| PSA | 17.07000 |
| LogP | 4.60530 |
| Index of Refraction | 1.587 |
| InChIKey | GBBHLKRNXLWUMF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2Br)c(C)c1 |
|
~%
Methanone, (2-b... CAS#:6279-93-2 |
| Literature: Fuson; Armstrong Journal of the American Chemical Society, 1941 , vol. 63, p. 2650 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Bromophenyl mesityl ketone |
| 2'-Brom-2,4,6-trimethyl-benzophenon |
| 2'-bromo-2,4,6-trimethyl-benzophenone |
| (2-bromophenyl)(2,4,6-trimethylphenyl)methanone |