1,3,7-trimethyl-8-phenoxy-purine-2,6-dione structure
|
Common Name | 1,3,7-trimethyl-8-phenoxy-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 6279-37-4 | Molecular Weight | 286.28600 | |
| Density | 1.37g/cm3 | Boiling Point | 481.9ºC at 760 mmHg | |
| Molecular Formula | C14H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.3ºC | |
| Name | 1,3,7-trimethyl-8-phenoxypurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 481.9ºC at 760 mmHg |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.28600 |
| Flash Point | 245.3ºC |
| Exact Mass | 286.10700 |
| PSA | 71.05000 |
| LogP | 0.76300 |
| Index of Refraction | 1.66 |
| InChIKey | NSTBRYLMPPVUSD-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(nc(Oc3ccccc3)n2C)n(C)c1=O |
|
~23%
1,3,7-trimethyl... CAS#:6279-37-4 |
| Literature: Strydom, Belinda; Bergh, Jacobus J.; Petzer, Jacobus P. European Journal of Medicinal Chemistry, 2011 , vol. 46, # 8 p. 3474 - 3485 |
|
~%
1,3,7-trimethyl... CAS#:6279-37-4 |
| Literature: Magnanini Chemische Berichte, 25 Ref. <1892>, 45 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| 8-Phenoxycaffeine |
| 1,3,7-trimethyl-8-phenoxy-3,7-dihydro-purine-2,6-dione |
| 1,3,7-Trimethyl-8-phenoxy-3,7-dihydro-purin-2,6-dion |
| 1,3,7-trimethyl-8-phenoxy-3,7-dihydro-1H-purine-2,6-dione |