ethyl N-(3-nitrophenyl)carbamate structure
|
Common Name | ethyl N-(3-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 6275-72-5 | Molecular Weight | 210.18700 | |
| Density | 1.336g/cm3 | Boiling Point | 276.2ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.9ºC | |
| Name | Methyl-thiophosphonsaeure-O-aethylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 276.2ºC at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 120.9ºC |
| Exact Mass | 210.06400 |
| PSA | 84.15000 |
| LogP | 2.75940 |
| Index of Refraction | 1.595 |
| InChIKey | JWPGACMNGJBXHB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cccc([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EMPSH |
| methyl-thiophosphonic acid O-ethyl ester |
| O-ethylmethylthiophosphonic acid |
| ethyl 3-nitrophenylcarbamate |
| 3-Nitro-phenylcarbaminsaeureethylester |
| methyl-phosphonothioic acid O-ethyl ester |
| Methyl-thiophosphonsaeure-O-ethylester |
| O-ethyl methylphosphonothioic acid |
| 3-Nitro-carbanilsaeure-aethylester |
| EMPTA |