5-morpholin-4-yl-1,5-diphenylpent-1-en-3-one
Modify Date: 2025-10-05 15:38:49
5-morpholin-4-yl-1,5-diphenylpent-1-en-3-one structure
|
Common Name | 5-morpholin-4-yl-1,5-diphenylpent-1-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 6275-21-4 | Molecular Weight | 321.41300 | |
| Density | 1.135g/cm3 | Boiling Point | 483.5ºC at 760 mmHg | |
| Molecular Formula | C21H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.2ºC | |
| Name | 5-morpholin-4-yl-1,5-diphenylpent-1-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 483.5ºC at 760 mmHg |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.41300 |
| Flash Point | 246.2ºC |
| Exact Mass | 321.17300 |
| PSA | 29.54000 |
| LogP | 3.67040 |
| Index of Refraction | 1.605 |
| InChIKey | YFPFQFKTAUHLTR-VAWYXSNFSA-N |
| SMILES | O=C(C=Cc1ccccc1)CC(c1ccccc1)N1CCOCC1 |
|
~%
5-morpholin-4-y... CAS#:6275-21-4 |
| Literature: Lutz et al. Journal of Organic Chemistry, 1949 , vol. 14, p. 982,994 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,5-Diphenyl-3-oxo-5-morpholino-pent-1-en |
| 5-morpholin-4-yl-1,5-diphenyl-pent-1-en-3-one |
| 5-methyl-pentadecane |
| 5-Methylpentadekan |
| Pentadecane,5-methyl |