1-(9-chlorofluoren-9-yl)ethanone
Modify Date: 2025-08-27 00:33:25
1-(9-chlorofluoren-9-yl)ethanone structure
|
Common Name | 1-(9-chlorofluoren-9-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 62731-58-2 | Molecular Weight | 242.70000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(9-chlorofluoren-9-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11ClO |
|---|---|
| Molecular Weight | 242.70000 |
| Exact Mass | 242.05000 |
| PSA | 17.07000 |
| LogP | 3.73840 |
| InChIKey | QPYRMPYHGQEOQX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(Cl)c2ccccc2-c2ccccc21 |
|
~%
1-(9-chlorofluo... CAS#:62731-58-2 |
| Literature: Greenhow et al. Journal of the Chemical Society, 1954 , p. 3116,3119 |
| 1-(9-chloro-fluoren-9-yl)-ethanone |
| 1-(9-Chlor-fluoren-9-yl)-aethanon |
| Ethanone,1-(9-chloro-9H-fluoren-9-yl) |