4-methyl-1-[2-(4-methyl-1-piperidyl)ethyl]-2H-pyridine structure
|
Common Name | 4-methyl-1-[2-(4-methyl-1-piperidyl)ethyl]-2H-pyridine | ||
|---|---|---|---|---|
| CAS Number | 6272-94-2 | Molecular Weight | 294.21000 | |
| Density | 0.944g/cm3 | Boiling Point | 332.5ºC at 760 mmHg | |
| Molecular Formula | C14H18BrN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.6ºC | |
| Name | 4-methyl-1-[2-(4-methylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.944g/cm3 |
|---|---|
| Boiling Point | 332.5ºC at 760 mmHg |
| Molecular Formula | C14H18BrN2+ |
| Molecular Weight | 294.21000 |
| Flash Point | 143.6ºC |
| Exact Mass | 293.06500 |
| PSA | 7.76000 |
| Index of Refraction | 1.505 |
| InChIKey | JGSIARHKGKYFOZ-UHFFFAOYSA-M |
| SMILES | Cc1cc[n+](CC[n+]2ccc(C)cc2)cc1.[Br-] |
|
~%
4-methyl-1-[2-(... CAS#:6272-94-2 |
| Literature: Hartwell; Pogorelskin Journal of the American Chemical Society, 1950 , vol. 72, p. 2040,2041 |
|
~%
4-methyl-1-[2-(... CAS#:6272-94-2 |
| Literature: Bunting, John W.; Toth, Andrea; Kanter, James P. Canadian Journal of Chemistry, 1992 , vol. 70, # 4 p. 1195 - 1203 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4,4'-dimethyl-1,1'-(1,2-ethanediyl)bispyridinium dibromide |
| 1,1'-(1,2-Ethanediyl)bis(4-methylpyridinium) dibromide |
| HMS2204C12 |
| 4,4'-Dimethyl-1,1'-aethandiyl-bis-pyridinium,Dibromid |
| 4,4'-dimethyl-1,1'-ethanediyl-bis-pyridinium,dibromide |