N-(3-methylphenyl)-1-morpholin-4-yl-1-phenylmethanimine
Modify Date: 2025-10-20 08:38:14
N-(3-methylphenyl)-1-morpholin-4-yl-1-phenylmethanimine structure
|
Common Name | N-(3-methylphenyl)-1-morpholin-4-yl-1-phenylmethanimine | ||
|---|---|---|---|---|
| CAS Number | 62718-48-3 | Molecular Weight | 280.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-methylphenyl)-1-morpholin-4-yl-1-phenylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20N2O |
|---|---|
| Molecular Weight | 280.36400 |
| Exact Mass | 280.15800 |
| PSA | 24.83000 |
| LogP | 3.34340 |
| InChIKey | UCNHEFSUIDATDF-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N=C(c2ccccc2)N2CCOCC2)c1 |
|
~%
N-(3-methylphen... CAS#:62718-48-3 |
| Literature: Ta-Shma,R.; Rappoport,Z. Journal of the American Chemical Society, 1977 , vol. 99, p. 1845 - 1858 |
| 4-(N-m-tolyl-benzimidoyl)-morpholine |
| Morpholine,4-[[(3-methylphenyl)imino]phenylmethyl] |