N,1-bis(4-nitrophenyl)-1-piperidin-1-ylmethanimine
Modify Date: 2025-09-16 20:20:22
N,1-bis(4-nitrophenyl)-1-piperidin-1-ylmethanimine structure
|
Common Name | N,1-bis(4-nitrophenyl)-1-piperidin-1-ylmethanimine | ||
|---|---|---|---|---|
| CAS Number | 62718-40-5 | Molecular Weight | 354.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,1-bis(4-nitrophenyl)-1-piperidin-1-ylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18N4O4 |
|---|---|
| Molecular Weight | 354.36000 |
| Exact Mass | 354.13300 |
| PSA | 107.24000 |
| LogP | 5.05150 |
| InChIKey | KHZQIEIAALOFTP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=C(c2ccc([N+](=O)[O-])cc2)N2CCCCC2)cc1 |
|
~%
N,1-bis(4-nitro... CAS#:62718-40-5 |
| Literature: Raison Journal of the Chemical Society, 1949 , p. 3319,3323 |
| 1-[4-nitro-N-(4-nitro-phenyl)-benzimidoyl]-piperidine |
| (1Z)-1,2-bis(4-nitrophenyl)-2-piperidyl-1-azaethene |