1-amino-4-anilino-9,10-dihydro-9,10-dioxoanthracene-2-sulphonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) structure
|
Common Name | 1-amino-4-anilino-9,10-dihydro-9,10-dioxoanthracene-2-sulphonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) | ||
|---|---|---|---|---|
| CAS Number | 62707-55-5 | Molecular Weight | 543.58900 | |
| Density | N/A | Boiling Point | 879.1ºC at 760mmHg | |
| Molecular Formula | C26H29N3O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 485.4ºC | |
| Name | 1-amino-4-anilino-9,10-dioxoanthracene-2-sulfonic acid,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 879.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C26H29N3O8S |
| Molecular Weight | 543.58900 |
| Flash Point | 485.4ºC |
| Exact Mass | 543.16800 |
| PSA | 198.87000 |
| LogP | 3.03480 |
| InChIKey | BIKNNKXWJMYFGK-UHFFFAOYSA-N |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccccc2)c2c1C(=O)c1ccccc1C2=O.OCCN(CCO)CCO |
| EINECS 263-705-4 |
| 1-Amino-4-(phenylamino)-2-anthraquinonesulfonic acid,triethanolamine salt |
| 2-Anthraquinonesulfonic acid,1-amino-4-anilino-,triethanolamine salt |
| 1-amino-9,10-dioxo-4-(phenylamino)-9,10-dihydroanthracene-2-sulfonic acid-2,2',2''-nitrilotriethanol(1:1) |