1,5-bis(methoxysulfonyl)pentane structure
|
Common Name | 1,5-bis(methoxysulfonyl)pentane | ||
|---|---|---|---|---|
| CAS Number | 6270-30-0 | Molecular Weight | 260.32800 | |
| Density | 1.309g/cm3 | Boiling Point | 459.9ºC at 760 mmHg | |
| Molecular Formula | C7H16O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232ºC | |
| Name | dimethyl pentane-1,5-disulfonate |
|---|
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 459.9ºC at 760 mmHg |
| Molecular Formula | C7H16O6S2 |
| Molecular Weight | 260.32800 |
| Flash Point | 232ºC |
| Exact Mass | 260.03900 |
| PSA | 103.50000 |
| LogP | 2.27070 |
| Index of Refraction | 1.47 |
| InChIKey | HKHAFRSSLRAKAQ-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)CCCCCS(=O)(=O)OC |
|
~%
1,5-bis(methoxy... CAS#:6270-30-0 |
| Literature: Johnston,T.P. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 399 - 402 |
|
~%
1,5-bis(methoxy... CAS#:6270-30-0 |
| Literature: Johnston,T.P. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 399 - 402 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |