3-morpholin-4-yl-1-(3,4,5-trimethoxyphenyl)propan-1-one structure
|
Common Name | 3-morpholin-4-yl-1-(3,4,5-trimethoxyphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 6269-86-9 | Molecular Weight | 345.81800 | |
| Density | 1.128g/cm3 | Boiling Point | 450.5ºC at 760 mmHg | |
| Molecular Formula | C16H24ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.2ºC | |
| Name | 3-morpholin-4-yl-1-(3,4,5-trimethoxyphenyl)propan-1-one,hydrochloride |
|---|
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 450.5ºC at 760 mmHg |
| Molecular Formula | C16H24ClNO5 |
| Molecular Weight | 345.81800 |
| Flash Point | 226.2ºC |
| Exact Mass | 345.13400 |
| PSA | 57.23000 |
| LogP | 2.35730 |
| Index of Refraction | 1.514 |
| InChIKey | KNXACQWTYHFWHI-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)CCN2CCOCC2)cc(OC)c1OC.Cl |
|
~%
3-morpholin-4-y... CAS#:6269-86-9 |
| Literature: Magdziarz, Tomasz; Lozowicka, Bozena; Gieleciak, Rafal; Bak, Andrzej; Polanski, Jaroslaw; Chilmonczyk, Zdzislaw Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 5 p. 1630 - 1643 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |