4-Morpholinepropanol,a-1,3-benzodioxol-5-yl-a-(4-methoxyphenyl)-
Modify Date: 2025-09-28 17:42:34
4-Morpholinepropanol,a-1,3-benzodioxol-5-yl-a-(4-methoxyphenyl)- structure
|
Common Name | 4-Morpholinepropanol,a-1,3-benzodioxol-5-yl-a-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6269-84-7 | Molecular Weight | 371.42700 | |
| Density | 1.238g/cm3 | Boiling Point | 572.4ºC at 760mmHg | |
| Molecular Formula | C21H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300ºC | |
| Name | 1-(1,3-benzodioxol-5-yl)-1-(4-methoxyphenyl)-3-morpholin-4-ylpropan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 572.4ºC at 760mmHg |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.42700 |
| Flash Point | 300ºC |
| Exact Mass | 371.17300 |
| PSA | 60.39000 |
| LogP | 2.32000 |
| Index of Refraction | 1.584 |
| InChIKey | ARBLWOAVYXCWCG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)(CCN2CCOCC2)c2ccc3c(c2)OCO3)cc1 |
|
~%
4-Morpholinepro... CAS#:6269-84-7 |
| Literature: Pettit,G.R.; Alkalay,D.S. Journal of Organic Chemistry, 1960 , vol. 25, p. 1363 - 1365 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-benzo[1,3]dioxol-5-yl-1-(4-methoxy-phenyl)-3-morpholin-4-yl-propan-1-ol |
| 1-(1,3-benzodioxol-5-yl)-1-(4-methoxyphenyl)-3-(morpholin-4-yl)propan-1-ol |