1-benzo[1,3]dioxol-5-yl-3-morpholin-4-yl-1-(3,4,5-trimethoxyphenyl)propan-1-ol structure
|
Common Name | 1-benzo[1,3]dioxol-5-yl-3-morpholin-4-yl-1-(3,4,5-trimethoxyphenyl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 6269-83-6 | Molecular Weight | 431.47900 | |
| Density | 1.239g/cm3 | Boiling Point | 610.2ºC at 760 mmHg | |
| Molecular Formula | C23H29NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.8ºC | |
| Name | 1-(1,3-benzodioxol-5-yl)-3-morpholin-4-yl-1-(3,4,5-trimethoxyphenyl)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 610.2ºC at 760 mmHg |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.47900 |
| Flash Point | 322.8ºC |
| Exact Mass | 431.19400 |
| PSA | 78.85000 |
| LogP | 2.33720 |
| Index of Refraction | 1.567 |
| InChIKey | XWBSCGPJAQTQQO-UHFFFAOYSA-N |
| SMILES | COc1cc(C(O)(CCN2CCOCC2)c2ccc3c(c2)OCO3)cc(OC)c1OC |
|
~%
1-benzo[1,3]dio... CAS#:6269-83-6 |
| Literature: Pettit,G.R.; Alkalay,D.S. Journal of Organic Chemistry, 1960 , vol. 25, p. 1363 - 1365 |
|
~%
1-benzo[1,3]dio... CAS#:6269-83-6 |
| Literature: Pettit,G.R.; Alkalay,D.S. Journal of Organic Chemistry, 1960 , vol. 25, p. 1363 - 1365 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-benzo[1,3]dioxol-5-yl-3-morpholin-4-yl-1-(3,4,5-trimethoxy-phenyl)-propan-1-ol |
| 1-(1,3-benzodioxol-5-yl)-3-(morpholin-4-yl)-1-(3,4,5-trimethoxyphenyl)propan-1-ol |