N-(6-acetamido-2-methyl-quinolin-4-yl)acetamide structure
|
Common Name | N-(6-acetamido-2-methyl-quinolin-4-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 6269-73-4 | Molecular Weight | 257.28800 | |
| Density | 1.291g/cm3 | Boiling Point | 574.1ºC at 760 mmHg | |
| Molecular Formula | C14H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301ºC | |
| Name | N-(4-acetamido-2-methylquinolin-6-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 574.1ºC at 760 mmHg |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.28800 |
| Flash Point | 301ºC |
| Exact Mass | 257.11600 |
| PSA | 71.09000 |
| LogP | 2.60600 |
| Index of Refraction | 1.683 |
| InChIKey | PIJNCTORROQKPU-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2nc(C)cc(NC(C)=O)c2c1 |
|
~%
N-(6-acetamido-... CAS#:6269-73-4 |
| Literature: Peng; Daniels Journal of the American Chemical Society, 1956 , vol. 78, p. 3703,3707 |
|
~%
N-(6-acetamido-... CAS#:6269-73-4 |
| Literature: Peng; Daniels Journal of the American Chemical Society, 1956 , vol. 78, p. 3703,3707 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,6-Bis-acetylamino-2-methyl-chinolin |
| 4,6-bis-acetylamino-2-methyl-quinoline |