Cyclohexanecarbamicacid, N-nitro-, ethyl ester (8CI)
Modify Date: 2025-11-30 18:05:38
Cyclohexanecarbamicacid, N-nitro-, ethyl ester (8CI) structure
|
Common Name | Cyclohexanecarbamicacid, N-nitro-, ethyl ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 6268-39-9 | Molecular Weight | 216.23400 | |
| Density | 1.18g/cm3 | Boiling Point | 307.5ºC at 760 mmHg | |
| Molecular Formula | C9H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.8ºC | |
| Name | ethyl N-cyclohexyl-N-nitrocarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 307.5ºC at 760 mmHg |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.23400 |
| Flash Point | 139.8ºC |
| Exact Mass | 216.11100 |
| PSA | 75.36000 |
| LogP | 2.49250 |
| Index of Refraction | 1.499 |
| InChIKey | AJJXRCYKNIXDLR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(C1CCCCC1)[N+](=O)[O-] |
|
~%
Cyclohexanecarb... CAS#:6268-39-9 |
| Literature: Curry; Mason Journal of the American Chemical Society, 1951 , vol. 73, p. 5043,5044 Journal of the American Chemical Society, 1953 , vol. 75, p. 6357 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| cyclohexyl-nitro-carbamic acid ethyl ester |
| Cyclohexyl-nitro-carbamidsaeure-aethylester |