1-(7-bromo-3-phenyl-4,1,2-benzothiadiazin-1-yl)ethanone structure
|
Common Name | 1-(7-bromo-3-phenyl-4,1,2-benzothiadiazin-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 62672-34-8 | Molecular Weight | 347.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11BrN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(7-bromo-3-phenyl-4,1,2-benzothiadiazin-1-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11BrN2OS |
|---|---|
| Molecular Weight | 347.23000 |
| Exact Mass | 345.97800 |
| PSA | 57.97000 |
| LogP | 3.77010 |
| InChIKey | FMXFTGXWSDFPSO-UHFFFAOYSA-N |
| SMILES | CC(=O)N1N=C(c2ccccc2)Sc2ccc(Br)cc21 |
|
~%
1-(7-bromo-3-ph... CAS#:62672-34-8 |
| Literature: Vukov,D.J. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 192 - 196 |
| 1-acetyl-7-bromo-3-phenyl-1H-benzo[1,3,4]thiadiazine |
| 1H-4,1,2-Benzothiadiazine,1-acetyl-7-bromo-3-phenyl |