2-Amino-6-methyl-4-nitrophenol structure
|
Common Name | 2-Amino-6-methyl-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 6265-03-8 | Molecular Weight | 168.15000 | |
| Density | 1.421g/cm3 | Boiling Point | 370.3ºC at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | 2-Amino-6-methyl-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 370.3ºC at 760 mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15000 |
| Flash Point | 177.7ºC |
| Exact Mass | 168.05300 |
| PSA | 92.07000 |
| LogP | 2.29540 |
| Index of Refraction | 1.661 |
| InChIKey | ZDMBLPBTZZZSIW-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])cc(N)c1O |
| HS Code | 2922299090 |
|---|
|
~%
2-Amino-6-methy... CAS#:6265-03-8 |
| Literature: Cazeneuve Bulletin de la Societe Chimique de France, 1897 , vol. <3> 17, p. 200 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Nitro-3-amino-2-oxy-toluol |
| 2-amino-6-methyl-4-nitro-phenol |
| 4-Nitro-6-amino-o-kresol |
| Phenol,2-amino-6-methyl-4-nitro |
| 5-Nitro-3-amino-2-oxy-1-methyl-benzol |