(3-chlorophenyl)-(2,4,6-trimethylphenyl)methanone
Modify Date: 2025-11-25 19:02:54
(3-chlorophenyl)-(2,4,6-trimethylphenyl)methanone structure
|
Common Name | (3-chlorophenyl)-(2,4,6-trimethylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 62646-19-9 | Molecular Weight | 258.74300 | |
| Density | 1.133g/cm3 | Boiling Point | 353.6ºC at 760 mmHg | |
| Molecular Formula | C16H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.7ºC | |
| Name | (3-chlorophenyl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 353.6ºC at 760 mmHg |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.74300 |
| Flash Point | 212.7ºC |
| Exact Mass | 258.08100 |
| PSA | 17.07000 |
| LogP | 4.49620 |
| Index of Refraction | 1.574 |
| InChIKey | HAFDRENBBRLLDI-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)c2cccc(Cl)c2)c(C)c1 |
|
~%
(3-chlorophenyl... CAS#:62646-19-9 |
| Literature: Newman; Scheurer Journal of the American Chemical Society, 1956 , vol. 78, p. 5004,5006 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4,6-trimethyl-3'-chlorobenzophenone |
| 2.4.6-Trimethyl-3'-chlorbenzophenon |
| (3-chlorophenyl)(2,4,6-trimethylphenyl)methanone |
| 3'-Chlor-2,4,6-trimethyl-benzophenon |
| 3'-chloro-2,4,6-trimethyl-benzophenone |