1-[[2-(1H-benzoimidazol-2-ylsulfanyl)acetyl]amino]-3-(2-methylphenyl)thiourea structure
|
Common Name | 1-[[2-(1H-benzoimidazol-2-ylsulfanyl)acetyl]amino]-3-(2-methylphenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 62638-89-5 | Molecular Weight | 371.48000 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H17N5OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]amino]-3-(2-methylphenyl)thiourea |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Molecular Formula | C17H17N5OS2 |
| Molecular Weight | 371.48000 |
| Exact Mass | 371.08700 |
| PSA | 139.23000 |
| LogP | 3.83600 |
| Index of Refraction | 1.744 |
| InChIKey | CJGLUXHTIYBGBU-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1NC(=S)NNC(=O)CSc1nc2ccccc2[nH]1 |
|
~86%
1-[[2-(1H-benzo... CAS#:62638-89-5 |
| Literature: Ibrahim El; Mohsen; Omar; Khalil Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 11 p. 1348 - 1350 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |