3-chloro-5-(ethylsulfanylcarbonylamino)-5-oxopent-3-enoic acid structure
|
Common Name | 3-chloro-5-(ethylsulfanylcarbonylamino)-5-oxopent-3-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 62616-40-4 | Molecular Weight | 251.68700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-5-(ethylsulfanylcarbonylamino)-5-oxopent-3-enoic acid |
|---|
| Molecular Formula | C8H10ClNO4S |
|---|---|
| Molecular Weight | 251.68700 |
| Exact Mass | 251.00200 |
| PSA | 112.26000 |
| LogP | 2.41340 |
| InChIKey | ATLPATHTJGVXJL-UHFFFAOYSA-N |
| SMILES | CCSC(=O)NC(=O)C=C(Cl)CC(=O)O |
|
~%
3-chloro-5-(eth... CAS#:62616-40-4 |
| Literature: Al-Rawi,J.M.A.; Elvidge,J.A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2462 - 2470 |
|
~%
3-chloro-5-(eth... CAS#:62616-40-4 |
| Literature: Al-Rawi,J.M.A.; Elvidge,J.A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2462 - 2470 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |