diethyl 2-(1-piperidylmethylidene)propanedioate
Modify Date: 2025-09-12 10:40:07
diethyl 2-(1-piperidylmethylidene)propanedioate structure
|
Common Name | diethyl 2-(1-piperidylmethylidene)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 62615-75-2 | Molecular Weight | 255.31000 | |
| Density | 1.146g/cm3 | Boiling Point | 313ºC at 760 mmHg | |
| Molecular Formula | C13H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.1ºC | |
| Name | diethyl 2-(piperidin-1-ylmethylidene)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 313ºC at 760 mmHg |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31000 |
| Flash Point | 143.1ºC |
| Exact Mass | 255.14700 |
| PSA | 55.84000 |
| LogP | 1.42030 |
| Index of Refraction | 1.531 |
| InChIKey | FAAZPFPFOALBGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CN1CCCCC1)C(=O)OCC |
|
~%
diethyl 2-(1-pi... CAS#:62615-75-2 |
| Literature: Ingold; Perren; Thorpe Journal of the Chemical Society, 1922 , vol. 121, p. 1782 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:17448-95-2| piperidin-1-ylmethylene-malonic acid diethyl ester |
| piperidinomethylene-malonic acid diethyl ester |
| 1,1-diethoxycarbonyl-2-piperidinoethene |
| Piperidinomethylen-malonsaeurediaethylester |