3-Methoxy-5-(methylsulfonyl)aniline structure
|
Common Name | 3-Methoxy-5-(methylsulfonyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 62606-02-4 | Molecular Weight | 201.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methoxy-5-methylsulfonylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H11NO3S |
|---|---|
| Molecular Weight | 201.24300 |
| Exact Mass | 201.04600 |
| PSA | 77.77000 |
| LogP | 2.34290 |
| InChIKey | XBZBDCOVNQRWPT-UHFFFAOYSA-N |
| SMILES | COc1cc(N)cc(S(C)(=O)=O)c1 |
|
~76%
3-Methoxy-5-(me... CAS#:62606-02-4 |
| Literature: Dominique, Romyr; Goodnow, JR., Robert Alan; Kowalczyk, Agnieszka; Lou, Jianping; Qiao, Qi; Siddurl, Achyutharao; Tilley, Jefferson Wright Patent: US2009/227603 A1, 2009 ; Location in patent: Page/Page column 43 ; US 20090227603 A1 |
|
~%
3-Methoxy-5-(me... CAS#:62606-02-4 |
| Literature: Emokpae,T.A.; Dosunma,I.M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 14 - 17 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-methanesulfonyl-5-methoxy-phenylamine |