ethyl 5-(4-methoxyphenyl)furan-3-carboxylate structure
|
Common Name | ethyl 5-(4-methoxyphenyl)furan-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 62596-44-5 | Molecular Weight | 246.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-(4-methoxyphenyl)furan-3-carboxylate |
|---|
| Molecular Formula | C14H14O4 |
|---|---|
| Molecular Weight | 246.25900 |
| Exact Mass | 246.08900 |
| PSA | 48.67000 |
| LogP | 3.13190 |
| InChIKey | SUAGJOGWTWCMML-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1coc(-c2ccc(OC)cc2)c1 |
|
~82%
ethyl 5-(4-meth... CAS#:62596-44-5 |
| Literature: Li, Ende; Yao, Wenjun; Xie, Xin; Wang, Chengyu; Shao, Yushang; Li, Yanzhong Organic and Biomolecular Chemistry, 2012 , vol. 10, # 15 p. 2960 - 2965 |
|
~%
ethyl 5-(4-meth... CAS#:62596-44-5 |
| Literature: Li, Ende; Yao, Wenjun; Xie, Xin; Wang, Chengyu; Shao, Yushang; Li, Yanzhong Organic and Biomolecular Chemistry, 2012 , vol. 10, # 15 p. 2960 - 2965 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |