6-(ethylamino)-4-hydroxynaphthalene-2-sulfonic acid
Modify Date: 2025-08-23 09:27:10
6-(ethylamino)-4-hydroxynaphthalene-2-sulfonic acid structure
|
Common Name | 6-(ethylamino)-4-hydroxynaphthalene-2-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6259-51-4 | Molecular Weight | 267.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(ethylamino)-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO4S |
|---|---|
| Molecular Weight | 267.30100 |
| Exact Mass | 267.05700 |
| PSA | 95.01000 |
| LogP | 3.37770 |
| InChIKey | NRNGQXBLASGPLB-UHFFFAOYSA-N |
| SMILES | CCNc1ccc2cc(S(=O)(=O)O)cc(O)c2c1 |
|
~%
6-(ethylamino)-... CAS#:6259-51-4 |
| Literature: Geigy and Co. Patent: DE91506 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 976 |
|
~%
6-(ethylamino)-... CAS#:6259-51-4 |
| Literature: Geigy and Co. Patent: DE91506 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 976 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-Aethylamino-4-hydroxy-naphthalin-2-sulfonsaeure |
| 6-ethylamino-4-hydroxy-naphthalene-2-sulfonic acid |
| 7-Aethylamino-naphthol-(1)-sulfonsaeure-(3) |