2-bromo-4-(4-methylsulfonylphenyl)aniline structure
|
Common Name | 2-bromo-4-(4-methylsulfonylphenyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 62579-69-5 | Molecular Weight | 326.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-4-(4-methylsulfonylphenyl)aniline |
|---|
| Molecular Formula | C13H12BrNO2S |
|---|---|
| Molecular Weight | 326.20900 |
| Exact Mass | 324.97700 |
| PSA | 68.54000 |
| LogP | 4.76380 |
| InChIKey | JALCGTZDHSAKDF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(N)c(Br)c2)cc1 |
|
~%
2-bromo-4-(4-me... CAS#:62579-69-5 |
| Literature: Guanti,G. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 137 - 140 |
|
~%
2-bromo-4-(4-me... CAS#:62579-69-5 |
| Literature: Guanti,G. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 137 - 140 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |