5-(4-bromophenyl)-2-nitroaniline
Modify Date: 2025-11-24 20:44:20
5-(4-bromophenyl)-2-nitroaniline structure
|
Common Name | 5-(4-bromophenyl)-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 62579-62-8 | Molecular Weight | 293.11600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-bromophenyl)-2-nitroaniline |
|---|
| Molecular Formula | C12H9BrN2O2 |
|---|---|
| Molecular Weight | 293.11600 |
| Exact Mass | 291.98500 |
| PSA | 71.84000 |
| LogP | 4.71090 |
| InChIKey | CPEJUGUGXFGIAT-UHFFFAOYSA-N |
| SMILES | Nc1cc(-c2ccc(Br)cc2)ccc1[N+](=O)[O-] |
|
~%
5-(4-bromopheny... CAS#:62579-62-8 |
| Literature: Guanti,G. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 137 - 140 |
|
~%
5-(4-bromopheny... CAS#:62579-62-8 |
| Literature: Guanti,G. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 137 - 140 |
![N-(4'-bromo-4-nitro-[1,1'-biphenyl]-3-yl)acetamide structure](https://image.chemsrc.com/caspic/473/62579-65-1.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |