2-methyl-4-phenylindeno[1,2-b]pyridin-5-one structure
|
Common Name | 2-methyl-4-phenylindeno[1,2-b]pyridin-5-one | ||
|---|---|---|---|---|
| CAS Number | 62578-46-5 | Molecular Weight | 271.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-4-phenylindeno[1,2-b]pyridin-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H13NO |
|---|---|
| Molecular Weight | 271.31300 |
| Exact Mass | 271.10000 |
| PSA | 29.96000 |
| LogP | 4.26840 |
| InChIKey | SCLKRGGNFXTSDK-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccc2)c2c(n1)-c1ccccc1C2=O |
|
~70%
2-methyl-4-phen... CAS#:62578-46-5 |
| Literature: Nitta, Makoto; Ohnuma, Manami; Iino, Yukio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 5 p. 1115 - 1118 |
|
~6%
2-methyl-4-phen... CAS#:62578-46-5 |
| Literature: Lusis; Muceniece; Stonkuss; Duburs Tetrahedron, 1991 , vol. 47, # 35 p. 7429 - 7436 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-methyl-4-phenyl-5-oxoindeno<1,2-b>pyridine |
| 3-Methyl-1-phenyl-4-azafluorenone |
| 2-methyl-4-phenyl-5H-indeno<pyridin-5-one |
| 1-Phenyl-3-methyl-4-azafluorenon |