ethyl 2-cyano-2-(1-methyl-5-oxopyrrolidin-2-ylidene)acetate
Modify Date: 2025-09-13 15:59:05
ethyl 2-cyano-2-(1-methyl-5-oxopyrrolidin-2-ylidene)acetate structure
|
Common Name | ethyl 2-cyano-2-(1-methyl-5-oxopyrrolidin-2-ylidene)acetate | ||
|---|---|---|---|---|
| CAS Number | 62565-10-0 | Molecular Weight | 208.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-cyano-2-(1-methyl-5-oxopyrrolidin-2-ylidene)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12N2O3 |
|---|---|
| Molecular Weight | 208.21400 |
| Exact Mass | 208.08500 |
| PSA | 70.40000 |
| LogP | 0.51728 |
| InChIKey | LSSAVXCKDCNXIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)=C1CCC(=O)N1C |
|
~%
ethyl 2-cyano-2... CAS#:62565-10-0 |
| Literature: Funke, Wolfgang; Hornig, Knut; Moeller, Manfred H.; Wuerthwein, Ernst-Ulrich Chemische Berichte, 1993 , vol. 126, # 9 p. 2069 - 2078 |
|
~%
ethyl 2-cyano-2... CAS#:62565-10-0 |
| Literature: Best; Thorpe Journal of the Chemical Society, 1909 , vol. 95, p. 1527 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Ethyl-1-methyl-5-cyanoacetylidene-2-pyrrolidone |