2,5-dimethyl-3-nitrobenzenesulfonyl chloride structure
|
Common Name | 2,5-dimethyl-3-nitrobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 62564-49-2 | Molecular Weight | 249.67100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-dimethyl-3-nitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8ClNO4S |
|---|---|
| Molecular Weight | 249.67100 |
| Exact Mass | 248.98600 |
| PSA | 88.34000 |
| LogP | 3.74310 |
| InChIKey | UPYQIZCIGYABBD-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])c(C)c(S(=O)(=O)Cl)c1 |
|
~%
2,5-dimethyl-3-... CAS#:62564-49-2 |
| Literature: Karslake; Huston Journal of the American Chemical Society, 1914 , vol. 36, p. 1247 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,5-dimethyl-3-nitro-benzenesulfonyl chloride |
| Benzenesulfonyl chloride,2,5-dimethyl-3-nitro |
| 2-Nitro-p-xylol-6-sulfonylchlorid |
| 2,5-Dimethyl-3-nitro-benzolsulfonylchlorid |