4-nitro-1-(3-nitrophenyl)pyrazole structure
|
Common Name | 4-nitro-1-(3-nitrophenyl)pyrazole | ||
|---|---|---|---|---|
| CAS Number | 62537-73-9 | Molecular Weight | 234.16800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-1-(3-nitrophenyl)pyrazole |
|---|
| Molecular Formula | C9H6N4O4 |
|---|---|
| Molecular Weight | 234.16800 |
| Exact Mass | 234.03900 |
| PSA | 109.46000 |
| LogP | 2.73510 |
| InChIKey | QFFHPGPZLCHVPK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-n2cc([N+](=O)[O-])cn2)c1 |
|
~%
4-nitro-1-(3-ni... CAS#:62537-73-9 |
| Literature: Finar; Hurlock Journal of the Chemical Society, 1957 , p. 3024,3025 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |