7-(6-bromo-1,3-benzodioxol-5-yl)-2,2-dimethylheptan-3-one structure
|
Common Name | 7-(6-bromo-1,3-benzodioxol-5-yl)-2,2-dimethylheptan-3-one | ||
|---|---|---|---|---|
| CAS Number | 62518-50-7 | Molecular Weight | 341.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(6-bromo-1,3-benzodioxol-5-yl)-2,2-dimethylheptan-3-one |
|---|
| Molecular Formula | C16H21BrO3 |
|---|---|
| Molecular Weight | 341.24000 |
| Exact Mass | 340.06700 |
| PSA | 35.53000 |
| LogP | 4.50580 |
| InChIKey | JAJRZFUZLXOEKI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CCCCc1cc2c(cc1Br)OCO2 |
|
~%
7-(6-bromo-1,3-... CAS#:62518-50-7 |
| Literature: Semmelhack, M. F.; Bargar, Thomas Journal of the American Chemical Society, 1980 , vol. 102, # 26 p. 7765 - 7774 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |